methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate

C15H21Br2NO2 — CID 63451582

IUPACmethyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate
SMILESCCCC(CCC)Nc1c(Br)cc(Br)cc1C(=O)OC
InChIInChI=1S/C15H21Br2NO2/c1-4-6-11(7-5-2)18-14-12(15(19)20-3)8-10(16)9-13(14)17/h8-9,11,18H,4-7H2,1-3H3
InChIKeyVEMKXPQWAREAAU-UHFFFAOYSA-N
MW407.15 g/mol
LogP5.38
Rot. Bonds7

About methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate

methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate (PubChem CID 63451582) has the molecular formula C15H21Br2NO2 and a molecular weight of 407.15 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate.

Molecular Properties

Compound Namemethyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate
PubChem CID63451582
Molecular FormulaC15H21Br2NO2
Molecular Weight407.15 g/mol
Exact Mass404.99
IUPAC Namemethyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate
SMILESCCCC(CCC)Nc1c(Br)cc(Br)cc1C(=O)OC
InChIInChI=1S/C15H21Br2NO2/c1-4-6-11(7-5-2)18-14-12(15(19)20-3)8-10(16)9-13(14)17/h8-9,11,18H,4-7H2,1-3H3
InChIKeyVEMKXPQWAREAAU-UHFFFAOYSA-N
XLogP5.38
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500407.15
LogP ≤ 55.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate?
The IUPAC name of methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate (CID 63451582) is methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate.
What is the SMILES notation for methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate?
The canonical SMILES for methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate is CCCC(CCC)Nc1c(Br)cc(Br)cc1C(=O)OC.
What is the InChIKey of methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate?
The InChIKey is VEMKXPQWAREAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Br2NO2/c1-4-6-11(7-5-2)18-14-12(15(19)20-3)8-10(16)9-13(14)17/h8-9,11,18H,4-7H2,1-3H3.
What are the key properties of methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate?
methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate has a molecular weight of 407.15 g/mol, XLogP of 5.38, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate is sourced from PubChem (CID 63451582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).