C15H21Br2NO2 — CID 63451582
methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate (PubChem CID 63451582) has the molecular formula C15H21Br2NO2 and a molecular weight of 407.15 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate.
| Compound Name | methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate |
|---|---|
| PubChem CID | 63451582 |
| Molecular Formula | C15H21Br2NO2 |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | methyl 3,5-dibromo-2-(heptan-4-ylamino)benzoate |
| SMILES | CCCC(CCC)Nc1c(Br)cc(Br)cc1C(=O)OC |
| InChI | InChI=1S/C15H21Br2NO2/c1-4-6-11(7-5-2)18-14-12(15(19)20-3)8-10(16)9-13(14)17/h8-9,11,18H,4-7H2,1-3H3 |
| InChIKey | VEMKXPQWAREAAU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |