C15H19Br2NO2 — CID 64501332
methyl 3,5-dibromo-2-[(3-ethylcyclopentyl)amino]benzoate (PubChem CID 64501332) has the molecular formula C15H19Br2NO2 and a molecular weight of 405.13 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-[(3-ethylcyclopentyl)amino]benzoate.
| Compound Name | methyl 3,5-dibromo-2-[(3-ethylcyclopentyl)amino]benzoate |
|---|---|
| PubChem CID | 64501332 |
| Molecular Formula | C15H19Br2NO2 |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | methyl 3,5-dibromo-2-[(3-ethylcyclopentyl)amino]benzoate |
| SMILES | CCC1CCC(Nc2c(Br)cc(Br)cc2C(=O)OC)C1 |
| InChI | InChI=1S/C15H19Br2NO2/c1-3-9-4-5-11(6-9)18-14-12(15(19)20-2)7-10(16)8-13(14)17/h7-9,11,18H,3-6H2,1-2H3 |
| InChIKey | SQOYXOBJRKJGAV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |