About methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate
methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate (PubChem CID 116676063) has the molecular formula C14H16Br2N2O3
and a molecular weight of 420.10 g/mol. Its IUPAC name is methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate.
Molecular Properties
| Compound Name | methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate |
| PubChem CID | 116676063 |
| Molecular Formula | C14H16Br2N2O3 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1NC(=O)C(C)C1CNC1 |
| InChI | InChI=1S/C14H16Br2N2O3/c1-7(8-5-17-6-8)13(19)18-12-10(14(20)21-2)3-9(15)4-11(12)16/h3-4,7-8,17H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | PYIBAPGKAWUFIZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate?
The IUPAC name of methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate (CID 116676063) is methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate.
What is the SMILES notation for methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate?
The canonical SMILES for methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate is COC(=O)c1cc(Br)cc(Br)c1NC(=O)C(C)C1CNC1.
What is the InChIKey of methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate?
The InChIKey is PYIBAPGKAWUFIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Br2N2O3/c1-7(8-5-17-6-8)13(19)18-12-10(14(20)21-2)3-9(15)4-11(12)16/h3-4,7-8,17H,5-6H2,1-2H3,(H,18,19).
What are the key properties of methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate?
methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate has a molecular weight of 420.10 g/mol, XLogP of 2.79, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(azetidin-3-yl)propanoylamino]-3,5-dibromobenzoate is sourced from PubChem (CID 116676063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).