C12H14Br2N2O3 — CID 54863064
methyl 2-(3-aminobutanoylamino)-3,5-dibromobenzoate (PubChem CID 54863064) has the molecular formula C12H14Br2N2O3 and a molecular weight of 394.06 g/mol. Its IUPAC name is methyl 2-(3-aminobutanoylamino)-3,5-dibromobenzoate.
| Compound Name | methyl 2-(3-aminobutanoylamino)-3,5-dibromobenzoate |
|---|---|
| PubChem CID | 54863064 |
| Molecular Formula | C12H14Br2N2O3 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | methyl 2-(3-aminobutanoylamino)-3,5-dibromobenzoate |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1NC(=O)CC(C)N |
| InChI | InChI=1S/C12H14Br2N2O3/c1-6(15)3-10(17)16-11-8(12(18)19-2)4-7(13)5-9(11)14/h4-6H,3,15H2,1-2H3,(H,16,17) |
| InChIKey | LSNLUKRDZIGXHW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |