C12H14Br2N2O4 — CID 79473751
methyl 2-[[2-(2-aminoethoxy)acetyl]amino]-3,5-dibromobenzoate (PubChem CID 79473751) has the molecular formula C12H14Br2N2O4 and a molecular weight of 410.06 g/mol. Its IUPAC name is methyl 2-[[2-(2-aminoethoxy)acetyl]amino]-3,5-dibromobenzoate.
| Compound Name | methyl 2-[[2-(2-aminoethoxy)acetyl]amino]-3,5-dibromobenzoate |
|---|---|
| PubChem CID | 79473751 |
| Molecular Formula | C12H14Br2N2O4 |
| Molecular Weight | 410.06 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | methyl 2-[[2-(2-aminoethoxy)acetyl]amino]-3,5-dibromobenzoate |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1NC(=O)COCCN |
| InChI | InChI=1S/C12H14Br2N2O4/c1-19-12(18)8-4-7(13)5-9(14)11(8)16-10(17)6-20-3-2-15/h4-5H,2-3,6,15H2,1H3,(H,16,17) |
| InChIKey | PSDLYKSIRLIBAL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.06 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|