C13H18BrNO3 — CID 113224139
N-(4-bromo-2,6-dimethylphenyl)-2-(2-methoxyethoxy)acetamide (PubChem CID 113224139) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 113224139 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)Nc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C13H18BrNO3/c1-9-6-11(14)7-10(2)13(9)15-12(16)8-18-5-4-17-3/h6-7H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | SUHIVNDYWOTYBK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|