C11H19N3O3 — CID 103606715
2-(2-methoxyethoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 103606715) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 103606715 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | COCCOCC(=O)Nc1c(C)nn(C)c1C |
| InChI | InChI=1S/C11H19N3O3/c1-8-11(9(2)14(3)13-8)12-10(15)7-17-6-5-16-4/h5-7H2,1-4H3,(H,12,15) |
| InChIKey | PFOAQWKQTYHQLM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|