C11H16N4O — CID 78912800
2-(prop-2-ynylamino)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 78912800) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-(prop-2-ynylamino)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | 2-(prop-2-ynylamino)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 78912800 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-(prop-2-ynylamino)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | C#CCNCC(=O)Nc1c(C)nn(C)c1C |
| InChI | InChI=1S/C11H16N4O/c1-5-6-12-7-10(16)13-11-8(2)14-15(4)9(11)3/h1,12H,6-7H2,2-4H3,(H,13,16) |
| InChIKey | UNKHHIMKCPQBBE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|