C9H15N3O2 — CID 60717287
2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 60717287) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | 2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 60717287 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-methoxy-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | COCC(=O)Nc1c(C)nn(C)c1C |
| InChI | InChI=1S/C9H15N3O2/c1-6-9(7(2)12(3)11-6)10-8(13)5-14-4/h5H2,1-4H3,(H,10,13) |
| InChIKey | NBHZBOSBXNSFQQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |