C14H12Cl5N3O2 — CID 78811961
2-(2,3,4,5,6-pentachlorophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 78811961) has the molecular formula C14H12Cl5N3O2 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentachlorophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | 2-(2,3,4,5,6-pentachlorophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 78811961 |
| Molecular Formula | C14H12Cl5N3O2 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 428.94 |
| IUPAC Name | 2-(2,3,4,5,6-pentachlorophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1NC(=O)COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C14H12Cl5N3O2/c1-5-13(6(2)22(3)21-5)20-7(23)4-24-14-11(18)9(16)8(15)10(17)12(14)19/h4H2,1-3H3,(H,20,23) |
| InChIKey | GQFYGYLLYORARO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|