methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate

C10H15N3O3 — CID 95748425

IUPACmethyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate
SMILESCCC(=O)Nc1c(C(=O)OC)nn(C)c1C
InChIInChI=1S/C10H15N3O3/c1-5-7(14)11-8-6(2)13(3)12-9(8)10(15)16-4/h5H2,1-4H3,(H,11,14)
InChIKeyRQSZPYQCHVFVTA-UHFFFAOYSA-N
MW225.25 g/mol
LogP0.86
Rot. Bonds3

About methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate

methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate (PubChem CID 95748425) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate.

Molecular Properties

Compound Namemethyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate
PubChem CID95748425
Molecular FormulaC10H15N3O3
Molecular Weight225.25 g/mol
Exact Mass225.11
IUPAC Namemethyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate
SMILESCCC(=O)Nc1c(C(=O)OC)nn(C)c1C
InChIInChI=1S/C10H15N3O3/c1-5-7(14)11-8-6(2)13(3)12-9(8)10(15)16-4/h5H2,1-4H3,(H,11,14)
InChIKeyRQSZPYQCHVFVTA-UHFFFAOYSA-N
XLogP0.86
TPSA73.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 50.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate?
The IUPAC name of methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate (CID 95748425) is methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate.
What is the SMILES notation for methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate?
The canonical SMILES for methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate is CCC(=O)Nc1c(C(=O)OC)nn(C)c1C.
What is the InChIKey of methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate?
The InChIKey is RQSZPYQCHVFVTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-5-7(14)11-8-6(2)13(3)12-9(8)10(15)16-4/h5H2,1-4H3,(H,11,14).
What are the key properties of methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate?
methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate has a molecular weight of 225.25 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,5-dimethyl-4-(propanoylamino)pyrazole-3-carboxylate is sourced from PubChem (CID 95748425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).