C8H12N2O2 — CID 144787574
methyl 1,4,5-trimethylpyrazole-3-carboxylate (PubChem CID 144787574) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is methyl 1,4,5-trimethylpyrazole-3-carboxylate.
| Compound Name | methyl 1,4,5-trimethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 144787574 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | methyl 1,4,5-trimethylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C)c(C)c1C |
| InChI | InChI=1S/C8H12N2O2/c1-5-6(2)10(3)9-7(5)8(11)12-4/h1-4H3 |
| InChIKey | LUBJPIILSUFTBV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |