C11H11Br2NO5 — CID 79345517
methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate (PubChem CID 79345517) has the molecular formula C11H11Br2NO5 and a molecular weight of 397.02 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate.
| Compound Name | methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate |
|---|---|
| PubChem CID | 79345517 |
| Molecular Formula | C11H11Br2NO5 |
| Molecular Weight | 397.02 g/mol |
| Exact Mass | 394.90 |
| IUPAC Name | methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1NC(=O)OCCO |
| InChI | InChI=1S/C11H11Br2NO5/c1-18-10(16)7-4-6(12)5-8(13)9(7)14-11(17)19-3-2-15/h4-5,15H,2-3H2,1H3,(H,14,17) |
| InChIKey | RVXICNNPUJNZBH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.02 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |