methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate

C11H11Br2NO5 — CID 79345517

IUPACmethyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate
SMILESCOC(=O)c1cc(Br)cc(Br)c1NC(=O)OCCO
InChIInChI=1S/C11H11Br2NO5/c1-18-10(16)7-4-6(12)5-8(13)9(7)14-11(17)19-3-2-15/h4-5,15H,2-3H2,1H3,(H,14,17)
InChIKeyRVXICNNPUJNZBH-UHFFFAOYSA-N
MW397.02 g/mol
LogP2.54
Rot. Bonds4

About methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate

methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate (PubChem CID 79345517) has the molecular formula C11H11Br2NO5 and a molecular weight of 397.02 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate.

Molecular Properties

Compound Namemethyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate
PubChem CID79345517
Molecular FormulaC11H11Br2NO5
Molecular Weight397.02 g/mol
Exact Mass394.90
IUPAC Namemethyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate
SMILESCOC(=O)c1cc(Br)cc(Br)c1NC(=O)OCCO
InChIInChI=1S/C11H11Br2NO5/c1-18-10(16)7-4-6(12)5-8(13)9(7)14-11(17)19-3-2-15/h4-5,15H,2-3H2,1H3,(H,14,17)
InChIKeyRVXICNNPUJNZBH-UHFFFAOYSA-N
XLogP2.54
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500397.02
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate?
The IUPAC name of methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate (CID 79345517) is methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate.
What is the SMILES notation for methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate?
The canonical SMILES for methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate is COC(=O)c1cc(Br)cc(Br)c1NC(=O)OCCO.
What is the InChIKey of methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate?
The InChIKey is RVXICNNPUJNZBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Br2NO5/c1-18-10(16)7-4-6(12)5-8(13)9(7)14-11(17)19-3-2-15/h4-5,15H,2-3H2,1H3,(H,14,17).
What are the key properties of methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate?
methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate has a molecular weight of 397.02 g/mol, XLogP of 2.54, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-dibromo-2-(2-hydroxyethoxycarbonylamino)benzoate is sourced from PubChem (CID 79345517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).