C9H8BrF2NO3 — CID 79349431
2-hydroxyethyl N-(4-bromo-2,6-difluorophenyl)carbamate (PubChem CID 79349431) has the molecular formula C9H8BrF2NO3 and a molecular weight of 296.07 g/mol. Its IUPAC name is 2-hydroxyethyl N-(4-bromo-2,6-difluorophenyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(4-bromo-2,6-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 79349431 |
| Molecular Formula | C9H8BrF2NO3 |
| Molecular Weight | 296.07 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 2-hydroxyethyl N-(4-bromo-2,6-difluorophenyl)carbamate |
| SMILES | O=C(Nc1c(F)cc(Br)cc1F)OCCO |
| InChI | InChI=1S/C9H8BrF2NO3/c10-5-3-6(11)8(7(12)4-5)13-9(15)16-2-1-14/h3-4,14H,1-2H2,(H,13,15) |
| InChIKey | QUJUUZYABWLREW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.07 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |