C9H8F2N2O5 — CID 81312067
2-hydroxyethyl N-(2,4-difluoro-6-nitrophenyl)carbamate (PubChem CID 81312067) has the molecular formula C9H8F2N2O5 and a molecular weight of 262.17 g/mol. Its IUPAC name is 2-hydroxyethyl N-(2,4-difluoro-6-nitrophenyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(2,4-difluoro-6-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 81312067 |
| Molecular Formula | C9H8F2N2O5 |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 2-hydroxyethyl N-(2,4-difluoro-6-nitrophenyl)carbamate |
| SMILES | O=C(Nc1c(F)cc(F)cc1[N+](=O)[O-])OCCO |
| InChI | InChI=1S/C9H8F2N2O5/c10-5-3-6(11)8(7(4-5)13(16)17)12-9(15)18-2-1-14/h3-4,14H,1-2H2,(H,12,15) |
| InChIKey | FTGZHXOKPFEUNJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|