C9H5F2N3O3 — CID 83298314
2-cyano-N-(2,4-difluoro-6-nitrophenyl)acetamide (PubChem CID 83298314) has the molecular formula C9H5F2N3O3 and a molecular weight of 241.15 g/mol. Its IUPAC name is 2-cyano-N-(2,4-difluoro-6-nitrophenyl)acetamide.
| Compound Name | 2-cyano-N-(2,4-difluoro-6-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 83298314 |
| Molecular Formula | C9H5F2N3O3 |
| Molecular Weight | 241.15 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 2-cyano-N-(2,4-difluoro-6-nitrophenyl)acetamide |
| SMILES | N#CCC(=O)Nc1c(F)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H5F2N3O3/c10-5-3-6(11)9(7(4-5)14(16)17)13-8(15)1-2-12/h3-4H,1H2,(H,13,15) |
| InChIKey | FZTJFOLBRGIMJI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|