C10H5F2N3O5 — CID 168520158
4-[(2-cyanoacetyl)amino]-2,3-difluoro-5-nitrobenzoic acid (PubChem CID 168520158) has the molecular formula C10H5F2N3O5 and a molecular weight of 285.16 g/mol. Its IUPAC name is 4-[(2-cyanoacetyl)amino]-2,3-difluoro-5-nitrobenzoic acid.
| Compound Name | 4-[(2-cyanoacetyl)amino]-2,3-difluoro-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 168520158 |
| Molecular Formula | C10H5F2N3O5 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 4-[(2-cyanoacetyl)amino]-2,3-difluoro-5-nitrobenzoic acid |
| SMILES | N#CCC(=O)Nc1c([N+](=O)[O-])cc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C10H5F2N3O5/c11-7-4(10(17)18)3-5(15(19)20)9(8(7)12)14-6(16)1-2-13/h3H,1H2,(H,14,16)(H,17,18) |
| InChIKey | UCFSCMLLQMVXJG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|