C9H4BrF2N3O3 — CID 168522473
N-(4-bromo-2,3-difluoro-6-nitrophenyl)-2-cyanoacetamide (PubChem CID 168522473) has the molecular formula C9H4BrF2N3O3 and a molecular weight of 320.05 g/mol. Its IUPAC name is N-(4-bromo-2,3-difluoro-6-nitrophenyl)-2-cyanoacetamide.
| Compound Name | N-(4-bromo-2,3-difluoro-6-nitrophenyl)-2-cyanoacetamide |
|---|---|
| PubChem CID | 168522473 |
| Molecular Formula | C9H4BrF2N3O3 |
| Molecular Weight | 320.05 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | N-(4-bromo-2,3-difluoro-6-nitrophenyl)-2-cyanoacetamide |
| SMILES | N#CCC(=O)Nc1c([N+](=O)[O-])cc(Br)c(F)c1F |
| InChI | InChI=1S/C9H4BrF2N3O3/c10-4-3-5(15(17)18)9(8(12)7(4)11)14-6(16)1-2-13/h3H,1H2,(H,14,16) |
| InChIKey | HXSPLFQNXFPSBW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.05 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|