C11H11BrF2N2O3 — CID 171735073
1-[(4-bromo-2,3-difluoro-6-nitroanilino)methyl]cyclobutan-1-ol (PubChem CID 171735073) has the molecular formula C11H11BrF2N2O3 and a molecular weight of 337.12 g/mol. Its IUPAC name is 1-[(4-bromo-2,3-difluoro-6-nitroanilino)methyl]cyclobutan-1-ol.
| Compound Name | 1-[(4-bromo-2,3-difluoro-6-nitroanilino)methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 171735073 |
| Molecular Formula | C11H11BrF2N2O3 |
| Molecular Weight | 337.12 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 1-[(4-bromo-2,3-difluoro-6-nitroanilino)methyl]cyclobutan-1-ol |
| SMILES | O=[N+]([O-])c1cc(Br)c(F)c(F)c1NCC1(O)CCC1 |
| InChI | InChI=1S/C11H11BrF2N2O3/c12-6-4-7(16(18)19)10(9(14)8(6)13)15-5-11(17)2-1-3-11/h4,15,17H,1-3,5H2 |
| InChIKey | VUMBJHGKZPEVIS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.12 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|