C7H3Br2FN2O3 — CID 168651769
N-(2,4-dibromo-3-fluoro-6-nitrophenyl)formamide (PubChem CID 168651769) has the molecular formula C7H3Br2FN2O3 and a molecular weight of 341.92 g/mol. Its IUPAC name is N-(2,4-dibromo-3-fluoro-6-nitrophenyl)formamide.
| Compound Name | N-(2,4-dibromo-3-fluoro-6-nitrophenyl)formamide |
|---|---|
| PubChem CID | 168651769 |
| Molecular Formula | C7H3Br2FN2O3 |
| Molecular Weight | 341.92 g/mol |
| Exact Mass | 339.85 |
| IUPAC Name | N-(2,4-dibromo-3-fluoro-6-nitrophenyl)formamide |
| SMILES | O=CNc1c([N+](=O)[O-])cc(Br)c(F)c1Br |
| InChI | InChI=1S/C7H3Br2FN2O3/c8-3-1-4(12(14)15)7(11-2-13)5(9)6(3)10/h1-2H,(H,11,13) |
| InChIKey | GUDLNHXVZJNFEJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.92 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|