C10H4Br2FN7O2 — CID 169346290
3-(2,4-dibromo-3-fluoro-6-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346290) has the molecular formula C10H4Br2FN7O2 and a molecular weight of 433.00 g/mol. Its IUPAC name is 3-(2,4-dibromo-3-fluoro-6-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(2,4-dibromo-3-fluoro-6-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346290 |
| Molecular Formula | C10H4Br2FN7O2 |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 430.88 |
| IUPAC Name | 3-(2,4-dibromo-3-fluoro-6-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1c([N+](=O)[O-])cc(Br)c(F)c1Br)c1nn[nH]n1 |
| InChI | InChI=1S/C10H4Br2FN7O2/c11-5-1-6(20(21)22)9(7(12)8(5)13)15-3-4(2-14)10-16-18-19-17-10/h1,3,15H,(H,16,17,18,19) |
| InChIKey | XVCIODKJFLIGMI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|