C10H5I2N7O2 — CID 169342726
3-(2,6-diiodo-4-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342726) has the molecular formula C10H5I2N7O2 and a molecular weight of 509.01 g/mol. Its IUPAC name is 3-(2,6-diiodo-4-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(2,6-diiodo-4-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342726 |
| Molecular Formula | C10H5I2N7O2 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.86 |
| IUPAC Name | 3-(2,6-diiodo-4-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1c(I)cc([N+](=O)[O-])cc1I)c1nn[nH]n1 |
| InChI | InChI=1S/C10H5I2N7O2/c11-7-1-6(19(20)21)2-8(12)9(7)14-4-5(3-13)10-15-17-18-16-10/h1-2,4,14H,(H,15,16,17,18) |
| InChIKey | ZIXLUVZGQDQORT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|