C12H9N7O3 — CID 169343338
3-(2-acetyl-4-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343338) has the molecular formula C12H9N7O3 and a molecular weight of 299.25 g/mol. Its IUPAC name is 3-(2-acetyl-4-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(2-acetyl-4-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343338 |
| Molecular Formula | C12H9N7O3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-(2-acetyl-4-nitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC(=O)c1cc([N+](=O)[O-])ccc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C12H9N7O3/c1-7(20)10-4-9(19(21)22)2-3-11(10)14-6-8(5-13)12-15-17-18-16-12/h2-4,6,14H,1H3,(H,15,16,17,18) |
| InChIKey | LNJPXGCILXPSOK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|