C10H5N9O3 — CID 169345760
3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345760) has the molecular formula C10H5N9O3 and a molecular weight of 299.21 g/mol. Its IUPAC name is 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345760 |
| Molecular Formula | C10H5N9O3 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc([N+](=O)[O-])c2nonc12)c1nn[nH]n1 |
| InChI | InChI=1S/C10H5N9O3/c11-3-5(10-13-17-18-14-10)4-12-6-1-2-7(19(20)21)9-8(6)15-22-16-9/h1-2,4,12H,(H,13,14,17,18) |
| InChIKey | IGSFBDHVUJIPRD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 172.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|