C12H9N7O4 — CID 169347005
methyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-6-nitrobenzoate (PubChem CID 169347005) has the molecular formula C12H9N7O4 and a molecular weight of 315.25 g/mol. Its IUPAC name is methyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-6-nitrobenzoate.
| Compound Name | methyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-6-nitrobenzoate |
|---|---|
| PubChem CID | 169347005 |
| Molecular Formula | C12H9N7O4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | methyl 2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-6-nitrobenzoate |
| SMILES | COC(=O)c1c(NC=C(C#N)c2nn[nH]n2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9N7O4/c1-23-12(20)10-8(3-2-4-9(10)19(21)22)14-6-7(5-13)11-15-17-18-16-11/h2-4,6,14H,1H3,(H,15,16,17,18) |
| InChIKey | UAHFMADQCMJFQM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|