C13H7F6N7O3 — CID 169346240
3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346240) has the molecular formula C13H7F6N7O3 and a molecular weight of 423.23 g/mol. Its IUPAC name is 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346240 |
| Molecular Formula | C13H7F6N7O3 |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-nitroanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1[N+](=O)[O-])c1nn[nH]n1 |
| InChI | InChI=1S/C13H7F6N7O3/c14-12(15,16)11(27,13(17,18)19)7-1-2-8(9(3-7)26(28)29)21-5-6(4-20)10-22-24-25-23-10/h1-3,5,21,27H,(H,22,23,24,25) |
| InChIKey | AYFAWZLRNSUFAW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|