C11H6F3N7O4S — CID 169345976
3-[2-nitro-4-(trifluoromethylsulfonyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345976) has the molecular formula C11H6F3N7O4S and a molecular weight of 389.28 g/mol. Its IUPAC name is 3-[2-nitro-4-(trifluoromethylsulfonyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-nitro-4-(trifluoromethylsulfonyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345976 |
| Molecular Formula | C11H6F3N7O4S |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 3-[2-nitro-4-(trifluoromethylsulfonyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-])c1nn[nH]n1 |
| InChI | InChI=1S/C11H6F3N7O4S/c12-11(13,14)26(24,25)7-1-2-8(9(3-7)21(22)23)16-5-6(4-15)10-17-19-20-18-10/h1-3,5,16H,(H,17,18,19,20) |
| InChIKey | PTXHEHPYAQUQEV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 167.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|