C10H6N8O4 — CID 169342691
3-(3,5-dinitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342691) has the molecular formula C10H6N8O4 and a molecular weight of 302.21 g/mol. Its IUPAC name is 3-(3,5-dinitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(3,5-dinitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342691 |
| Molecular Formula | C10H6N8O4 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-(3,5-dinitroanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1nn[nH]n1 |
| InChI | InChI=1S/C10H6N8O4/c11-4-6(10-13-15-16-14-10)5-12-7-1-8(17(19)20)3-9(2-7)18(21)22/h1-3,5,12H,(H,13,14,15,16) |
| InChIKey | DDDYZYJCSJGQDX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 176.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|