C10H6N6O2 — CID 132601605
(Z)-3-(4-nitrophenyl)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 132601605) has the molecular formula C10H6N6O2 and a molecular weight of 242.20 g/mol. Its IUPAC name is (Z)-3-(4-nitrophenyl)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(4-nitrophenyl)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 132601605 |
| Molecular Formula | C10H6N6O2 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (Z)-3-(4-nitrophenyl)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc([N+](=O)[O-])cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C10H6N6O2/c11-6-8(10-12-14-15-13-10)5-7-1-3-9(4-2-7)16(17)18/h1-5H,(H,12,13,14,15)/b8-5- |
| InChIKey | KDBMRYMTOMUWQK-YVMONPNESA-N |
| XLogP | 1.17 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|