C8H6N7O2- — CID 135708218
[(Z)-(4-nitrophenyl)methylideneamino]-(2H-tetrazol-5-yl)azanide (PubChem CID 135708218) has the molecular formula C8H6N7O2- and a molecular weight of 232.18 g/mol. Its IUPAC name is [(Z)-(4-nitrophenyl)methylideneamino]-(2H-tetrazol-5-yl)azanide.
| Compound Name | [(Z)-(4-nitrophenyl)methylideneamino]-(2H-tetrazol-5-yl)azanide |
|---|---|
| PubChem CID | 135708218 |
| Molecular Formula | C8H6N7O2- |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | [(Z)-(4-nitrophenyl)methylideneamino]-(2H-tetrazol-5-yl)azanide |
| SMILES | O=[N+]([O-])c1ccc(/C=N\[N-]c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C8H6N7O2/c16-15(17)7-3-1-6(2-4-7)5-9-10-8-11-13-14-12-8/h1-5H,(H-,10,11,12,13,14)/q-1/b9-5- |
| InChIKey | SODHAGNCXURNFK-UITAMQMPSA-N |
| XLogP | 1.15 |
| TPSA | 124.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|