C12H13N8O3- — CID 135737268
[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-(2H-tetrazol-5-yl)azanide (PubChem CID 135737268) has the molecular formula C12H13N8O3- and a molecular weight of 317.29 g/mol. Its IUPAC name is [(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-(2H-tetrazol-5-yl)azanide.
| Compound Name | [(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-(2H-tetrazol-5-yl)azanide |
|---|---|
| PubChem CID | 135737268 |
| Molecular Formula | C12H13N8O3- |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-(2H-tetrazol-5-yl)azanide |
| SMILES | O=[N+]([O-])c1cc(/C=N\[N-]c2nn[nH]n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C12H13N8O3/c21-20(22)11-7-9(8-13-14-12-15-17-18-16-12)1-2-10(11)19-3-5-23-6-4-19/h1-2,7-8H,3-6H2,(H-,14,15,16,17,18)/q-1/b13-8- |
| InChIKey | HXEMKNCYIVXLGL-JYRVWZFOSA-N |
| XLogP | 0.98 |
| TPSA | 136.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|