C16H17N5O6S — CID 168620871
2-[2-[(4-morpholin-4-yl-3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168620871) has the molecular formula C16H17N5O6S and a molecular weight of 407.41 g/mol. Its IUPAC name is 2-[2-[(4-morpholin-4-yl-3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(4-morpholin-4-yl-3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168620871 |
| Molecular Formula | C16H17N5O6S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 2-[2-[(4-morpholin-4-yl-3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc(N3CCOCC3)c([N+](=O)[O-])c2)NC1=O |
| InChI | InChI=1S/C16H17N5O6S/c22-14(23)8-13-15(24)18-16(28-13)19-17-9-10-1-2-11(12(7-10)21(25)26)20-3-5-27-6-4-20/h1-2,7,9,13H,3-6,8H2,(H,22,23)(H,18,19,24) |
| InChIKey | ZKWGYFYLIJTXFP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 146.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|