C13H14BN3O5S — CID 168620092
2-[2-[(4-borono-3-methylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168620092) has the molecular formula C13H14BN3O5S and a molecular weight of 335.15 g/mol. Its IUPAC name is 2-[2-[(4-borono-3-methylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(4-borono-3-methylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168620092 |
| Molecular Formula | C13H14BN3O5S |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-[2-[(4-borono-3-methylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cc1cc(C=NN=C2NC(=O)C(CC(=O)O)S2)ccc1B(O)O |
| InChI | InChI=1S/C13H14BN3O5S/c1-7-4-8(2-3-9(7)14(21)22)6-15-17-13-16-12(20)10(23-13)5-11(18)19/h2-4,6,10,21-22H,5H2,1H3,(H,18,19)(H,16,17,20) |
| InChIKey | URZNZILOCPOFKE-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|