C15H9F8N3O3S — CID 168622050
2-[4-oxo-2-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622050) has the molecular formula C15H9F8N3O3S and a molecular weight of 463.31 g/mol. Its IUPAC name is 2-[4-oxo-2-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[4-oxo-2-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622050 |
| Molecular Formula | C15H9F8N3O3S |
| Molecular Weight | 463.31 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 2-[4-oxo-2-[[3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc(C(F)(F)F)c(C(F)(F)C(F)(F)F)c2)NC1=O |
| InChI | InChI=1S/C15H9F8N3O3S/c16-13(17,15(21,22)23)8-3-6(1-2-7(8)14(18,19)20)5-24-26-12-25-11(29)9(30-12)4-10(27)28/h1-3,5,9H,4H2,(H,27,28)(H,25,26,29) |
| InChIKey | LZQPKLHCQQPXES-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|