C17H17F3N4O3S — CID 168620642
2-[4-oxo-2-[[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168620642) has the molecular formula C17H17F3N4O3S and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-[4-oxo-2-[[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[4-oxo-2-[[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168620642 |
| Molecular Formula | C17H17F3N4O3S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[4-oxo-2-[[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc(N3CCCC3)c(C(F)(F)F)c2)NC1=O |
| InChI | InChI=1S/C17H17F3N4O3S/c18-17(19,20)11-7-10(3-4-12(11)24-5-1-2-6-24)9-21-23-16-22-15(27)13(28-16)8-14(25)26/h3-4,7,9,13H,1-2,5-6,8H2,(H,25,26)(H,22,23,27) |
| InChIKey | ROXAPRCFGMQWMU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|