C13H11N3O6S — CID 168619759
5-[[[5-(carboxymethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2-hydroxybenzoic acid (PubChem CID 168619759) has the molecular formula C13H11N3O6S and a molecular weight of 337.31 g/mol. Its IUPAC name is 5-[[[5-(carboxymethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[[5-(carboxymethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 168619759 |
| Molecular Formula | C13H11N3O6S |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 5-[[[5-(carboxymethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc(O)c(C(=O)O)c2)NC1=O |
| InChI | InChI=1S/C13H11N3O6S/c17-8-2-1-6(3-7(8)12(21)22)5-14-16-13-15-11(20)9(23-13)4-10(18)19/h1-3,5,9,17H,4H2,(H,18,19)(H,21,22)(H,15,16,20) |
| InChIKey | ZQSNAPXGNPUCCN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|