C19H14ClN3O5S — CID 168620944
4-[4-[[[5-(carboxymethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]-2-chlorobenzoic acid (PubChem CID 168620944) has the molecular formula C19H14ClN3O5S and a molecular weight of 431.86 g/mol. Its IUPAC name is 4-[4-[[[5-(carboxymethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]-2-chlorobenzoic acid.
| Compound Name | 4-[4-[[[5-(carboxymethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 168620944 |
| Molecular Formula | C19H14ClN3O5S |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 4-[4-[[[5-(carboxymethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]-2-chlorobenzoic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc(-c3ccc(C(=O)O)c(Cl)c3)cc2)NC1=O |
| InChI | InChI=1S/C19H14ClN3O5S/c20-14-7-12(5-6-13(14)18(27)28)11-3-1-10(2-4-11)9-21-23-19-22-17(26)15(29-19)8-16(24)25/h1-7,9,15H,8H2,(H,24,25)(H,27,28)(H,22,23,26) |
| InChIKey | RUGYCQFHBYWAGP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|