C19H24BN3O5S — CID 168622257
2-[2-[[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622257) has the molecular formula C19H24BN3O5S and a molecular weight of 417.30 g/mol. Its IUPAC name is 2-[2-[[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622257 |
| Molecular Formula | C19H24BN3O5S |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[2-[[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cc1cc(C=NN=C2NC(=O)C(CC(=O)O)S2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H24BN3O5S/c1-11-8-12(6-7-13(11)20-27-18(2,3)19(4,5)28-20)10-21-23-17-22-16(26)14(29-17)9-15(24)25/h6-8,10,14H,9H2,1-5H3,(H,24,25)(H,22,23,26) |
| InChIKey | JJEGZDRHUMFSIH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|