C16H17N4O4S- — CID 135768505
2-[(2E,5R)-2-[(Z)-(4-morpholin-4-ylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135768505) has the molecular formula C16H17N4O4S- and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-[(2E,5R)-2-[(Z)-(4-morpholin-4-ylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2E,5R)-2-[(Z)-(4-morpholin-4-ylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135768505 |
| Molecular Formula | C16H17N4O4S- |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[(2E,5R)-2-[(Z)-(4-morpholin-4-ylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | O=C([O-])C[C@H]1S/C(=N/N=C\c2ccc(N3CCOCC3)cc2)NC1=O |
| InChI | InChI=1S/C16H18N4O4S/c21-14(22)9-13-15(23)18-16(25-13)19-17-10-11-1-3-12(4-2-11)20-5-7-24-8-6-20/h1-4,10,13H,5-9H2,(H,21,22)(H,18,19,23)/p-1/b17-10-/t13-/m1/s1 |
| InChIKey | FSEJBKICUFFJRC-OMJMQIJPSA-M |
| XLogP | -0.42 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|