C15H16N3O4S- — CID 135748103
2-[(2E,5R)-4-oxo-2-[(Z)-(4-propan-2-yloxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetate (PubChem CID 135748103) has the molecular formula C15H16N3O4S- and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[(2E,5R)-4-oxo-2-[(Z)-(4-propan-2-yloxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2E,5R)-4-oxo-2-[(Z)-(4-propan-2-yloxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135748103 |
| Molecular Formula | C15H16N3O4S- |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-[(2E,5R)-4-oxo-2-[(Z)-(4-propan-2-yloxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetate |
| SMILES | CC(C)Oc1ccc(/C=N\N=C2/NC(=O)[C@@H](CC(=O)[O-])S2)cc1 |
| InChI | InChI=1S/C15H17N3O4S/c1-9(2)22-11-5-3-10(4-6-11)8-16-18-15-17-14(21)12(23-15)7-13(19)20/h3-6,8-9,12H,7H2,1-2H3,(H,19,20)(H,17,18,21)/p-1/b16-8-/t12-/m1/s1 |
| InChIKey | TZCLAFHHBLUOCC-VJMCZWTHSA-M |
| XLogP | 0.54 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|