C20H16N3O5S- — CID 135852235
2-[(2Z,5S)-2-[(Z)-[4-(4-methylbenzoyl)oxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135852235) has the molecular formula C20H16N3O5S- and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[(2Z,5S)-2-[(Z)-[4-(4-methylbenzoyl)oxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2Z,5S)-2-[(Z)-[4-(4-methylbenzoyl)oxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135852235 |
| Molecular Formula | C20H16N3O5S- |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-[(2Z,5S)-2-[(Z)-[4-(4-methylbenzoyl)oxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(/C=N\N=C3\NC(=O)[C@H](CC(=O)[O-])S3)cc2)cc1 |
| InChI | InChI=1S/C20H17N3O5S/c1-12-2-6-14(7-3-12)19(27)28-15-8-4-13(5-9-15)11-21-23-20-22-18(26)16(29-20)10-17(24)25/h2-9,11,16H,10H2,1H3,(H,24,25)(H,22,23,26)/p-1/b21-11-/t16-/m0/s1 |
| InChIKey | MCYMFXPNXVBQNG-SJJOQSKNSA-M |
| XLogP | 1.28 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|