C19H14N3O5S- — CID 135923470
2-[(2Z,5S)-2-[(Z)-(4-benzoyloxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135923470) has the molecular formula C19H14N3O5S- and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[(2Z,5S)-2-[(Z)-(4-benzoyloxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2Z,5S)-2-[(Z)-(4-benzoyloxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135923470 |
| Molecular Formula | C19H14N3O5S- |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2-[(2Z,5S)-2-[(Z)-(4-benzoyloxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | O=C([O-])C[C@@H]1S/C(=N\N=C/c2ccc(OC(=O)c3ccccc3)cc2)NC1=O |
| InChI | InChI=1S/C19H15N3O5S/c23-16(24)10-15-17(25)21-19(28-15)22-20-11-12-6-8-14(9-7-12)27-18(26)13-4-2-1-3-5-13/h1-9,11,15H,10H2,(H,23,24)(H,21,22,25)/p-1/b20-11-/t15-/m0/s1 |
| InChIKey | ZVSWXLSZRQGRLK-PFHZTYADSA-M |
| XLogP | 0.97 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|