C19H16N3O4S- — CID 135976004
2-[(2E,5R)-4-oxo-2-[(Z)-(3-phenylmethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetate (PubChem CID 135976004) has the molecular formula C19H16N3O4S- and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[(2E,5R)-4-oxo-2-[(Z)-(3-phenylmethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2E,5R)-4-oxo-2-[(Z)-(3-phenylmethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135976004 |
| Molecular Formula | C19H16N3O4S- |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-[(2E,5R)-4-oxo-2-[(Z)-(3-phenylmethoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetate |
| SMILES | O=C([O-])C[C@H]1S/C(=N/N=C\c2cccc(OCc3ccccc3)c2)NC1=O |
| InChI | InChI=1S/C19H17N3O4S/c23-17(24)10-16-18(25)21-19(27-16)22-20-11-14-7-4-8-15(9-14)26-12-13-5-2-1-3-6-13/h1-9,11,16H,10,12H2,(H,23,24)(H,21,22,25)/p-1/b20-11-/t16-/m1/s1 |
| InChIKey | HZNMIWMTFVMNCX-IWEBCOIVSA-M |
| XLogP | 1.33 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|