C12H9ClN3O3S- — CID 135852167
2-[(2E,5S)-2-[(Z)-(3-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135852167) has the molecular formula C12H9ClN3O3S- and a molecular weight of 310.74 g/mol. Its IUPAC name is 2-[(2E,5S)-2-[(Z)-(3-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2E,5S)-2-[(Z)-(3-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135852167 |
| Molecular Formula | C12H9ClN3O3S- |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-[(2E,5S)-2-[(Z)-(3-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | O=C([O-])C[C@@H]1S/C(=N/N=C\c2cccc(Cl)c2)NC1=O |
| InChI | InChI=1S/C12H10ClN3O3S/c13-8-3-1-2-7(4-8)6-14-16-12-15-11(19)9(20-12)5-10(17)18/h1-4,6,9H,5H2,(H,17,18)(H,15,16,19)/p-1/b14-6-/t9-/m0/s1 |
| InChIKey | ZRTGMGCIYFPTCT-VYJZUSIPSA-M |
| XLogP | 0.40 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|