C18H14Cl2N4O2S — CID 135452196
N-(3-chlorophenyl)-2-[2-[(4-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135452196) has the molecular formula C18H14Cl2N4O2S and a molecular weight of 421.31 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[2-[(4-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[2-[(4-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135452196 |
| Molecular Formula | C18H14Cl2N4O2S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | N-(3-chlorophenyl)-2-[2-[(4-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1SC(=NN=Cc2ccc(Cl)cc2)NC1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N4O2S/c19-12-6-4-11(5-7-12)10-21-24-18-23-17(26)15(27-18)9-16(25)22-14-3-1-2-13(20)8-14/h1-8,10,15H,9H2,(H,22,25)(H,23,24,26) |
| InChIKey | YYUGHGXKLUHQPM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|