C19H17ClN4O3S — CID 135659010
2-[(2Z)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 135659010) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is 2-[(2Z)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(2Z)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135659010 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-[(2Z)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2S/C(=N\N=C\c3ccc(Cl)cc3)NC2=O)cc1 |
| InChI | InChI=1S/C19H17ClN4O3S/c1-27-15-8-6-14(7-9-15)22-17(25)10-16-18(26)23-19(28-16)24-21-11-12-2-4-13(20)5-3-12/h2-9,11,16H,10H2,1H3,(H,22,25)(H,23,24,26)/b21-11+ |
| InChIKey | BQBOKJZYZCMTHE-SRZZPIQSSA-N |
| XLogP | 3.30 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|