C14H15N5O4S — CID 135798637
N-carbamoyl-2-[(2E)-2-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135798637) has the molecular formula C14H15N5O4S and a molecular weight of 349.37 g/mol. Its IUPAC name is N-carbamoyl-2-[(2E)-2-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-carbamoyl-2-[(2E)-2-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135798637 |
| Molecular Formula | C14H15N5O4S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-carbamoyl-2-[(2E)-2-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1ccc(/C=N/N=C2\NC(=O)C(CC(=O)NC(N)=O)S2)cc1 |
| InChI | InChI=1S/C14H15N5O4S/c1-23-9-4-2-8(3-5-9)7-16-19-14-18-12(21)10(24-14)6-11(20)17-13(15)22/h2-5,7,10H,6H2,1H3,(H,18,19,21)(H3,15,17,20,22)/b16-7+ |
| InChIKey | XTFPHKVUWXRNJE-FRKPEAEDSA-N |
| XLogP | 0.20 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|