C19H16BrN3O3S — CID 135847141
(2E)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135847141) has the molecular formula C19H16BrN3O3S and a molecular weight of 446.33 g/mol. Its IUPAC name is (2E)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135847141 |
| Molecular Formula | C19H16BrN3O3S |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | (2E)-5-[2-(4-bromophenyl)-2-oxoethyl]-2-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=N/N=C2\NC(=O)C(CC(=O)c3ccc(Br)cc3)S2)cc1 |
| InChI | InChI=1S/C19H16BrN3O3S/c1-26-15-8-2-12(3-9-15)11-21-23-19-22-18(25)17(27-19)10-16(24)13-4-6-14(20)7-5-13/h2-9,11,17H,10H2,1H3,(H,22,23,25)/b21-11+ |
| InChIKey | JKGGMVQHLCKETR-SRZZPIQSSA-N |
| XLogP | 3.65 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|