C19H16N4O5S — CID 135762149
(2Z)-5-[2-(4-methoxyphenyl)-2-oxoethyl]-2-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135762149) has the molecular formula C19H16N4O5S and a molecular weight of 412.43 g/mol. Its IUPAC name is (2Z)-5-[2-(4-methoxyphenyl)-2-oxoethyl]-2-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-5-[2-(4-methoxyphenyl)-2-oxoethyl]-2-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135762149 |
| Molecular Formula | C19H16N4O5S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (2Z)-5-[2-(4-methoxyphenyl)-2-oxoethyl]-2-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C(=O)CC2S/C(=N\N=C\c3cccc([N+](=O)[O-])c3)NC2=O)cc1 |
| InChI | InChI=1S/C19H16N4O5S/c1-28-15-7-5-13(6-8-15)16(24)10-17-18(25)21-19(29-17)22-20-11-12-3-2-4-14(9-12)23(26)27/h2-9,11,17H,10H2,1H3,(H,21,22,25)/b20-11+ |
| InChIKey | XGPFUMKHFYQCRZ-RGVLZGJSSA-N |
| XLogP | 2.80 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|