C23H18Cl2N4O4S — CID 135711880
2-[(2E)-2-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 135711880) has the molecular formula C23H18Cl2N4O4S and a molecular weight of 517.39 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(2E)-2-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135711880 |
| Molecular Formula | C23H18Cl2N4O4S |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 2-[(2E)-2-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2S/C(=N/N=C/c3ccc(-c4cc(Cl)ccc4Cl)o3)NC2=O)cc1 |
| InChI | InChI=1S/C23H18Cl2N4O4S/c1-32-15-5-3-14(4-6-15)27-21(30)11-20-22(31)28-23(34-20)29-26-12-16-7-9-19(33-16)17-10-13(24)2-8-18(17)25/h2-10,12,20H,11H2,1H3,(H,27,30)(H,28,29,31)/b26-12+ |
| InChIKey | IZGIMNMJYPDOBY-RPPGKUMJSA-N |
| XLogP | 5.21 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|